C9H10F3N5 — CID 170485601
4-(4-azidobut-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole (PubChem CID 170485601) has the molecular formula C9H10F3N5 and a molecular weight of 245.21 g/mol. Its IUPAC name is 4-(4-azidobut-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 4-(4-azidobut-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 170485601 |
| Molecular Formula | C9H10F3N5 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 4-(4-azidobut-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole |
| SMILES | Cc1[nH]nc(C(F)(F)F)c1C=CCCN=[N+]=[N-] |
| InChI | InChI=1S/C9H10F3N5/c1-6-7(4-2-3-5-14-17-13)8(16-15-6)9(10,11)12/h2,4H,3,5H2,1H3,(H,15,16) |
| InChIKey | NCZLHGSTERPTDB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|