C8H13F3N2 — CID 144506272
4,5-dimethyl-3-(trifluoromethyl)-1H-pyrazole;ethane (PubChem CID 144506272) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is 4,5-dimethyl-3-(trifluoromethyl)-1H-pyrazole;ethane.
| Compound Name | 4,5-dimethyl-3-(trifluoromethyl)-1H-pyrazole;ethane |
|---|---|
| PubChem CID | 144506272 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 4,5-dimethyl-3-(trifluoromethyl)-1H-pyrazole;ethane |
| SMILES | CC.Cc1[nH]nc(C(F)(F)F)c1C |
| InChI | InChI=1S/C6H7F3N2.C2H6/c1-3-4(2)10-11-5(3)6(7,8)9;1-2/h1-2H3,(H,10,11);1-2H3 |
| InChIKey | ADLXUAJSOJNICK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |