C7H13N3 — CID 650797
2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine (PubChem CID 650797) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine.
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 650797 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine |
| SMILES | Cc1n[nH]c(C)c1CCN |
| InChI | InChI=1S/C7H13N3/c1-5-7(3-4-8)6(2)10-9-5/h3-4,8H2,1-2H3,(H,9,10) |
| InChIKey | MBQAPXFDQYOMRE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |