About 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride
2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride (PubChem CID 6603655) has the molecular formula C7H14ClN3
and a molecular weight of 175.66 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride |
| PubChem CID | 6603655 |
| Molecular Formula | C7H14ClN3 |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride |
| SMILES | Cc1n[nH]c(C)c1CCN.Cl |
| InChI | InChI=1S/C7H13N3.ClH/c1-5-7(3-4-8)6(2)10-9-5;/h3-4,8H2,1-2H3,(H,9,10);1H |
| InChIKey | QLKMMTQYHWZUKR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride (CID 6603655) is 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride is Cc1n[nH]c(C)c1CCN.Cl.
What is the InChIKey of 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride?
The InChIKey is QLKMMTQYHWZUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.ClH/c1-5-7(3-4-8)6(2)10-9-5;/h3-4,8H2,1-2H3,(H,9,10);1H.
What are the key properties of 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride?
2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride has a molecular weight of 175.66 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1H-pyrazol-4-yl)ethanamine;hydrochloride is sourced from PubChem (CID 6603655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).