C8H9FN2 — CID 123537109
4-ethenyl-5-fluoro-3-prop-1-enyl-1H-pyrazole (PubChem CID 123537109) has the molecular formula C8H9FN2 and a molecular weight of 152.17 g/mol. Its IUPAC name is 4-ethenyl-5-fluoro-3-prop-1-enyl-1H-pyrazole.
| Compound Name | 4-ethenyl-5-fluoro-3-prop-1-enyl-1H-pyrazole |
|---|---|
| PubChem CID | 123537109 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 4-ethenyl-5-fluoro-3-prop-1-enyl-1H-pyrazole |
| SMILES | C=Cc1c(C=CC)n[nH]c1F |
| InChI | InChI=1S/C8H9FN2/c1-3-5-7-6(4-2)8(9)11-10-7/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | NIWHJZUYUKLNHH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |