C16H18F3N3 — CID 143156309
4-ethenyl-5-[(1Z,4Z,6E)-4-ethenyl-8,8,8-trifluoro-7-methylocta-1,4,6-trienyl]-1H-pyrazol-3-amine (PubChem CID 143156309) has the molecular formula C16H18F3N3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-ethenyl-5-[(1Z,4Z,6E)-4-ethenyl-8,8,8-trifluoro-7-methylocta-1,4,6-trienyl]-1H-pyrazol-3-amine.
| Compound Name | 4-ethenyl-5-[(1Z,4Z,6E)-4-ethenyl-8,8,8-trifluoro-7-methylocta-1,4,6-trienyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 143156309 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-ethenyl-5-[(1Z,4Z,6E)-4-ethenyl-8,8,8-trifluoro-7-methylocta-1,4,6-trienyl]-1H-pyrazol-3-amine |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)C/C=C\c1[nH]nc(N)c1C=C |
| InChI | InChI=1S/C16H18F3N3/c1-4-12(10-9-11(3)16(17,18)19)7-6-8-14-13(5-2)15(20)22-21-14/h4-6,8-10H,1-2,7H2,3H3,(H3,20,21,22)/b8-6-,11-9+,12-10+ |
| InChIKey | JJQIAULEEZFOFJ-BSPFAPSJSA-N |
| XLogP | 4.66 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|