C7H11N3 — CID 129048961
5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine (PubChem CID 129048961) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine.
| Compound Name | 5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 129048961 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 5-methyl-4-[(Z)-prop-1-enyl]-1H-pyrazol-3-amine |
| SMILES | C/C=C\c1c(N)n[nH]c1C |
| InChI | InChI=1S/C7H11N3/c1-3-4-6-5(2)9-10-7(6)8/h3-4H,1-2H3,(H3,8,9,10)/b4-3- |
| InChIKey | ULKLQLCCAIZLOG-ARJAWSKDSA-N |
| XLogP | 1.33 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |