C8H8F3N5 — CID 169462047
4-(3-azidoprop-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole (PubChem CID 169462047) has the molecular formula C8H8F3N5 and a molecular weight of 231.18 g/mol. Its IUPAC name is 4-(3-azidoprop-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole.
| Compound Name | 4-(3-azidoprop-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 169462047 |
| Molecular Formula | C8H8F3N5 |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-(3-azidoprop-1-enyl)-5-methyl-3-(trifluoromethyl)-1H-pyrazole |
| SMILES | Cc1[nH]nc(C(F)(F)F)c1C=CCN=[N+]=[N-] |
| InChI | InChI=1S/C8H8F3N5/c1-5-6(3-2-4-13-16-12)7(15-14-5)8(9,10)11/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | VGAGEFDOJQYTJF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|