C6H7F3N2O2S — CID 20675413
methyl 5-methyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfinate (PubChem CID 20675413) has the molecular formula C6H7F3N2O2S and a molecular weight of 228.19 g/mol. Its IUPAC name is methyl 5-methyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfinate.
| Compound Name | methyl 5-methyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfinate |
|---|---|
| PubChem CID | 20675413 |
| Molecular Formula | C6H7F3N2O2S |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | methyl 5-methyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfinate |
| SMILES | COS(=O)c1c(C(F)(F)F)n[nH]c1C |
| InChI | InChI=1S/C6H7F3N2O2S/c1-3-4(14(12)13-2)5(11-10-3)6(7,8)9/h1-2H3,(H,10,11) |
| InChIKey | ZEMFFZMDKBVICK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |