C11H19NOS — CID 116891359
3-methyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)butan-1-ol (PubChem CID 116891359) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 3-methyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)butan-1-ol.
| Compound Name | 3-methyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 116891359 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-methyl-2-(2-propan-2-yl-1,3-thiazol-4-yl)butan-1-ol |
| SMILES | CC(C)c1nc(C(CO)C(C)C)cs1 |
| InChI | InChI=1S/C11H19NOS/c1-7(2)9(5-13)10-6-14-11(12-10)8(3)4/h6-9,13H,5H2,1-4H3 |
| InChIKey | WBCVQMDYEZSBNZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |