C14H16BrNOS — CID 116891373
2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-3-methylbutan-1-ol (PubChem CID 116891373) has the molecular formula C14H16BrNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-3-methylbutan-1-ol.
| Compound Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 116891373 |
| Molecular Formula | C14H16BrNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)c1csc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C14H16BrNOS/c1-9(2)12(7-17)13-8-18-14(16-13)10-4-3-5-11(15)6-10/h3-6,8-9,12,17H,7H2,1-2H3 |
| InChIKey | VUKIMECYGCAJKP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |