C21H19N3O4S2 — CID 32843044
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate (PubChem CID 32843044) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 32843044 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(2-cyanoethylsulfamoyl)benzoate |
| SMILES | Cc1ccc(-c2nc(COC(=O)c3ccc(S(=O)(=O)NCCC#N)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H19N3O4S2/c1-15-3-5-16(6-4-15)20-24-18(14-29-20)13-28-21(25)17-7-9-19(10-8-17)30(26,27)23-12-2-11-22/h3-10,14,23H,2,12-13H2,1H3 |
| InChIKey | DATVBFMXAZWSBY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|