C18H16N2O3S2 — CID 16625749
(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2-acetamido-3-methylbenzoate (PubChem CID 16625749) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2-acetamido-3-methylbenzoate.
| Compound Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2-acetamido-3-methylbenzoate |
|---|---|
| PubChem CID | 16625749 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2-acetamido-3-methylbenzoate |
| SMILES | CC(=O)Nc1c(C)cccc1C(=O)OCc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-11-4-3-5-15(16(11)19-12(2)21)18(22)23-8-14-10-25-17(20-14)13-6-7-24-9-13/h3-7,9-10H,8H2,1-2H3,(H,19,21) |
| InChIKey | JXFHZNWTBGUAFJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |