C22H22N6O6S — CID 24627201
6-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 24627201) has the molecular formula C22H22N6O6S and a molecular weight of 498.52 g/mol. Its IUPAC name is 6-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 24627201 |
| Molecular Formula | C22H22N6O6S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 6-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | COc1ccc(-c2noc(CN3CCN(S(=O)(=O)c4ccc5[nH]c(=O)c(=O)[nH]c5c4)CC3)n2)cc1 |
| InChI | InChI=1S/C22H22N6O6S/c1-33-15-4-2-14(3-5-15)20-25-19(34-26-20)13-27-8-10-28(11-9-27)35(31,32)16-6-7-17-18(12-16)24-22(30)21(29)23-17/h2-7,12H,8-11,13H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | KEULWALYJHKWDC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 154.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|