C21H31N3OS — CID 57388879
2-[4-[5-(4-propan-2-ylphenoxy)pentyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 57388879) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 2-[4-[5-(4-propan-2-ylphenoxy)pentyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[5-(4-propan-2-ylphenoxy)pentyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 57388879 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[4-[5-(4-propan-2-ylphenoxy)pentyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | CC(C)c1ccc(OCCCCCN2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C21H31N3OS/c1-18(2)19-6-8-20(9-7-19)25-16-5-3-4-11-23-12-14-24(15-13-23)21-22-10-17-26-21/h6-10,17-18H,3-5,11-16H2,1-2H3 |
| InChIKey | WVRPCXLNACBFFF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|