C10H14Cl2N2OS — CID 80688038
4-chloro-5-(chloromethyl)-2-(4-methoxypiperidin-1-yl)-1,3-thiazole (PubChem CID 80688038) has the molecular formula C10H14Cl2N2OS and a molecular weight of 281.21 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-(4-methoxypiperidin-1-yl)-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-(4-methoxypiperidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 80688038 |
| Molecular Formula | C10H14Cl2N2OS |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-(4-methoxypiperidin-1-yl)-1,3-thiazole |
| SMILES | COC1CCN(c2nc(Cl)c(CCl)s2)CC1 |
| InChI | InChI=1S/C10H14Cl2N2OS/c1-15-7-2-4-14(5-3-7)10-13-9(12)8(6-11)16-10/h7H,2-6H2,1H3 |
| InChIKey | XYUWAQGZSPDWQU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|