C12H19ClN4 — CID 63634840
3-(chloromethyl)-6-(3,3,4-trimethylpiperazin-1-yl)pyridazine (PubChem CID 63634840) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-(chloromethyl)-6-(3,3,4-trimethylpiperazin-1-yl)pyridazine.
| Compound Name | 3-(chloromethyl)-6-(3,3,4-trimethylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 63634840 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-(chloromethyl)-6-(3,3,4-trimethylpiperazin-1-yl)pyridazine |
| SMILES | CN1CCN(c2ccc(CCl)nn2)CC1(C)C |
| InChI | InChI=1S/C12H19ClN4/c1-12(2)9-17(7-6-16(12)3)11-5-4-10(8-13)14-15-11/h4-5H,6-9H2,1-3H3 |
| InChIKey | COGOOZMLFVIVLM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|