About 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine
4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine (PubChem CID 66233004) has the molecular formula C12H18ClN3
and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine.
Molecular Properties
| Compound Name | 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine |
| PubChem CID | 66233004 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine |
| SMILES | CN1CCN(c2ccc(Cl)cn2)CC1(C)C |
| InChI | InChI=1S/C12H18ClN3/c1-12(2)9-16(7-6-15(12)3)11-5-4-10(13)8-14-11/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | KEVOQFURGQOMBK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine?
The IUPAC name of 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine (CID 66233004) is 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine.
What is the SMILES notation for 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine?
The canonical SMILES for 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine is CN1CCN(c2ccc(Cl)cn2)CC1(C)C.
What is the InChIKey of 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine?
The InChIKey is KEVOQFURGQOMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3/c1-12(2)9-16(7-6-15(12)3)11-5-4-10(13)8-14-11/h4-5,8H,6-7,9H2,1-3H3.
What are the key properties of 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine?
4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine has a molecular weight of 239.75 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine is sourced from PubChem (CID 66233004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).