C12H18ClN3 — CID 66233004
4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine (PubChem CID 66233004) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine.
| Compound Name | 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine |
|---|---|
| PubChem CID | 66233004 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-1,2,2-trimethylpiperazine |
| SMILES | CN1CCN(c2ccc(Cl)cn2)CC1(C)C |
| InChI | InChI=1S/C12H18ClN3/c1-12(2)9-16(7-6-15(12)3)11-5-4-10(13)8-14-11/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | KEVOQFURGQOMBK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |