C14H20ClN3 — CID 56749174
7-(5-chloro-2-pyridinyl)-2-methyl-2,7-diazaspiro[4.5]decane (PubChem CID 56749174) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 7-(5-chloro-2-pyridinyl)-2-methyl-2,7-diazaspiro[4.5]decane.
| Compound Name | 7-(5-chloro-2-pyridinyl)-2-methyl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 56749174 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 7-(5-chloro-2-pyridinyl)-2-methyl-2,7-diazaspiro[4.5]decane |
| SMILES | CN1CCC2(CCCN(c3ccc(Cl)cn3)C2)C1 |
| InChI | InChI=1S/C14H20ClN3/c1-17-8-6-14(10-17)5-2-7-18(11-14)13-4-3-12(15)9-16-13/h3-4,9H,2,5-8,10-11H2,1H3 |
| InChIKey | IWRNQBHZTUMIOX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |