C9H9ClN2 — CID 172881511
5-chloro-2-(2,5-dihydropyrrol-1-yl)pyridine (PubChem CID 172881511) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 5-chloro-2-(2,5-dihydropyrrol-1-yl)pyridine.
| Compound Name | 5-chloro-2-(2,5-dihydropyrrol-1-yl)pyridine |
|---|---|
| PubChem CID | 172881511 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 5-chloro-2-(2,5-dihydropyrrol-1-yl)pyridine |
| SMILES | Clc1ccc(N2CC=CC2)nc1 |
| InChI | InChI=1S/C9H9ClN2/c10-8-3-4-9(11-7-8)12-5-1-2-6-12/h1-4,7H,5-6H2 |
| InChIKey | SGWSAZLBLYFIIK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|