C11H13ClN2 — CID 175610084
5-chloro-2-(3-methyl-3,6-dihydro-2H-pyridin-1-yl)pyridine (PubChem CID 175610084) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is 5-chloro-2-(3-methyl-3,6-dihydro-2H-pyridin-1-yl)pyridine.
| Compound Name | 5-chloro-2-(3-methyl-3,6-dihydro-2H-pyridin-1-yl)pyridine |
|---|---|
| PubChem CID | 175610084 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-chloro-2-(3-methyl-3,6-dihydro-2H-pyridin-1-yl)pyridine |
| SMILES | CC1C=CCN(c2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C11H13ClN2/c1-9-3-2-6-14(8-9)11-5-4-10(12)7-13-11/h2-5,7,9H,6,8H2,1H3 |
| InChIKey | KLYVXSBHAUNDMW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|