C12H12ClN3O2 — CID 121183872
1-[1-(5-chloro-2-pyridinyl)azetidin-3-yl]pyrrolidine-2,5-dione (PubChem CID 121183872) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-pyridinyl)azetidin-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1-(5-chloro-2-pyridinyl)azetidin-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 121183872 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 1-[1-(5-chloro-2-pyridinyl)azetidin-3-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1C1CN(c2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C12H12ClN3O2/c13-8-1-2-10(14-5-8)15-6-9(7-15)16-11(17)3-4-12(16)18/h1-2,5,9H,3-4,6-7H2 |
| InChIKey | XONTVJOQNYPWFG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|