C11H14ClN3O — CID 128980942
(3S,4S)-1-(5-chloro-2-pyridinyl)-4-methylpyrrolidine-3-carboxamide (PubChem CID 128980942) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is (3S,4S)-1-(5-chloro-2-pyridinyl)-4-methylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-(5-chloro-2-pyridinyl)-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 128980942 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (3S,4S)-1-(5-chloro-2-pyridinyl)-4-methylpyrrolidine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(Cl)cn2)C[C@H]1C(N)=O |
| InChI | InChI=1S/C11H14ClN3O/c1-7-5-15(6-9(7)11(13)16)10-3-2-8(12)4-14-10/h2-4,7,9H,5-6H2,1H3,(H2,13,16)/t7-,9-/m1/s1 |
| InChIKey | PMEKMIRCKIGIOK-VXNVDRBHSA-N |
| XLogP | 1.29 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |