C21H24ClN5O — CID 75464215
4-(5-chloro-2-pyridinyl)-N-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 75464215) has the molecular formula C21H24ClN5O and a molecular weight of 397.91 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-N-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-(5-chloro-2-pyridinyl)-N-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 75464215 |
| Molecular Formula | C21H24ClN5O |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-N-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccc(N2CC=CC2)cc1)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C21H24ClN5O/c22-18-5-8-20(23-16-18)26-11-13-27(14-12-26)21(28)24-15-17-3-6-19(7-4-17)25-9-1-2-10-25/h1-8,16H,9-15H2,(H,24,28) |
| InChIKey | RIDLRUGKMYAASU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|