C13H15N3O3S — CID 102884295
2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 102884295) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 102884295 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CC1CS(=O)(=O)CCN1c1nc2ccccn2c1C=O |
| InChI | InChI=1S/C13H15N3O3S/c1-10-9-20(18,19)7-6-15(10)13-11(8-17)16-5-3-2-4-12(16)14-13/h2-5,8,10H,6-7,9H2,1H3 |
| InChIKey | YHICBTBCWRHZBR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|