C13H16BrN3O2S — CID 107085444
4-[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-3-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 107085444) has the molecular formula C13H16BrN3O2S and a molecular weight of 358.26 g/mol. Its IUPAC name is 4-[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-3-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-3-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 107085444 |
| Molecular Formula | C13H16BrN3O2S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 4-[3-(bromomethyl)imidazo[1,2-a]pyridin-2-yl]-3-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CS(=O)(=O)CCN1c1nc2ccccn2c1CBr |
| InChI | InChI=1S/C13H16BrN3O2S/c1-10-9-20(18,19)7-6-16(10)13-11(8-14)17-5-3-2-4-12(17)15-13/h2-5,10H,6-9H2,1H3 |
| InChIKey | WQUZPXGHTLXUIM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|