C14H19BrN4 — CID 107079661
3-(bromomethyl)-2-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridine (PubChem CID 107079661) has the molecular formula C14H19BrN4 and a molecular weight of 323.24 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(bromomethyl)-2-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 107079661 |
| Molecular Formula | C14H19BrN4 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-(bromomethyl)-2-(4-methyl-1,4-diazepan-1-yl)imidazo[1,2-a]pyridine |
| SMILES | CN1CCCN(c2nc3ccccn3c2CBr)CC1 |
| InChI | InChI=1S/C14H19BrN4/c1-17-6-4-7-18(10-9-17)14-12(11-15)19-8-3-2-5-13(19)16-14/h2-3,5,8H,4,6-7,9-11H2,1H3 |
| InChIKey | ZHVNGZBZAJZDKE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|