C16H21BrN4 — CID 107081425
3-(bromomethyl)-2-[4-(cyclopropylmethyl)piperazin-1-yl]imidazo[1,2-a]pyridine (PubChem CID 107081425) has the molecular formula C16H21BrN4 and a molecular weight of 349.28 g/mol. Its IUPAC name is 3-(bromomethyl)-2-[4-(cyclopropylmethyl)piperazin-1-yl]imidazo[1,2-a]pyridine.
| Compound Name | 3-(bromomethyl)-2-[4-(cyclopropylmethyl)piperazin-1-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 107081425 |
| Molecular Formula | C16H21BrN4 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-(bromomethyl)-2-[4-(cyclopropylmethyl)piperazin-1-yl]imidazo[1,2-a]pyridine |
| SMILES | BrCc1c(N2CCN(CC3CC3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C16H21BrN4/c17-11-14-16(18-15-3-1-2-6-21(14)15)20-9-7-19(8-10-20)12-13-4-5-13/h1-3,6,13H,4-5,7-12H2 |
| InChIKey | YJAZVEOGGJHBMU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|