C15H20ClN3 — CID 43584737
3-(chloromethyl)-2-(3-ethylpiperidin-1-yl)imidazo[1,2-a]pyridine (PubChem CID 43584737) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(3-ethylpiperidin-1-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(chloromethyl)-2-(3-ethylpiperidin-1-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 43584737 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-(chloromethyl)-2-(3-ethylpiperidin-1-yl)imidazo[1,2-a]pyridine |
| SMILES | CCC1CCCN(c2nc3ccccn3c2CCl)C1 |
| InChI | InChI=1S/C15H20ClN3/c1-2-12-6-5-8-18(11-12)15-13(10-16)19-9-4-3-7-14(19)17-15/h3-4,7,9,12H,2,5-6,8,10-11H2,1H3 |
| InChIKey | XLSIEUZNPCQALX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|