C15H20N4O — CID 43586157
2-[4-(dimethylamino)piperidin-1-yl]imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 43586157) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[4-(dimethylamino)piperidin-1-yl]imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-[4-(dimethylamino)piperidin-1-yl]imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 43586157 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[4-(dimethylamino)piperidin-1-yl]imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CN(C)C1CCN(c2nc3ccccn3c2C=O)CC1 |
| InChI | InChI=1S/C15H20N4O/c1-17(2)12-6-9-18(10-7-12)15-13(11-20)19-8-4-3-5-14(19)16-15/h3-5,8,11-12H,6-7,9-10H2,1-2H3 |
| InChIKey | GZDHCHVUSKAKJU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|