C13H16N4O2S — CID 102887639
4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinazolin-2-amine (PubChem CID 102887639) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinazolin-2-amine.
| Compound Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 102887639 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinazolin-2-amine |
| SMILES | CC1CS(=O)(=O)CCN1c1nc(N)nc2ccccc12 |
| InChI | InChI=1S/C13H16N4O2S/c1-9-8-20(18,19)7-6-17(9)12-10-4-2-3-5-11(10)15-13(14)16-12/h2-5,9H,6-8H2,1H3,(H2,14,15,16) |
| InChIKey | ZNXWDHZMJREYTH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |