C12H14FNO3S — CID 43581566
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]ethanone (PubChem CID 43581566) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]ethanone.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 43581566 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(F)ccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H14FNO3S/c1-9(15)11-8-10(13)2-3-12(11)14-4-6-18(16,17)7-5-14/h2-3,8H,4-7H2,1H3 |
| InChIKey | CXDVYMHJRPCKRP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |