C13H19NO4S — CID 102884585
2-(1-hydroxyethyl)-5-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenol (PubChem CID 102884585) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-5-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenol.
| Compound Name | 2-(1-hydroxyethyl)-5-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenol |
|---|---|
| PubChem CID | 102884585 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(1-hydroxyethyl)-5-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenol |
| SMILES | CC(O)c1ccc(N2CCS(=O)(=O)CC2C)cc1O |
| InChI | InChI=1S/C13H19NO4S/c1-9-8-19(17,18)6-5-14(9)11-3-4-12(10(2)15)13(16)7-11/h3-4,7,9-10,15-16H,5-6,8H2,1-2H3 |
| InChIKey | SVSDOUQSFKEQCO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|