C12H18N2O2S — CID 102882558
2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline (PubChem CID 102882558) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline.
| Compound Name | 2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline |
|---|---|
| PubChem CID | 102882558 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-methyl-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline |
| SMILES | Cc1cc(N2CCS(=O)(=O)CC2C)ccc1N |
| InChI | InChI=1S/C12H18N2O2S/c1-9-7-11(3-4-12(9)13)14-5-6-17(15,16)8-10(14)2/h3-4,7,10H,5-6,8,13H2,1-2H3 |
| InChIKey | JHWUVFFIXYXECL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|