C10H12F2N2O2S — CID 113325166
2-(1,1-dioxo-1,4-thiazinan-4-yl)-4,6-difluoroaniline (PubChem CID 113325166) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4,6-difluoroaniline.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4,6-difluoroaniline |
|---|---|
| PubChem CID | 113325166 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-4,6-difluoroaniline |
| SMILES | Nc1c(F)cc(F)cc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H12F2N2O2S/c11-7-5-8(12)10(13)9(6-7)14-1-3-17(15,16)4-2-14/h5-6H,1-4,13H2 |
| InChIKey | OSMWKTUWNIVEDC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|