C11H14F2N2 — CID 115506411
2,4-difluoro-6-piperidin-1-ylaniline (PubChem CID 115506411) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,4-difluoro-6-piperidin-1-ylaniline.
| Compound Name | 2,4-difluoro-6-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 115506411 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2,4-difluoro-6-piperidin-1-ylaniline |
| SMILES | Nc1c(F)cc(F)cc1N1CCCCC1 |
| InChI | InChI=1S/C11H14F2N2/c12-8-6-9(13)11(14)10(7-8)15-4-2-1-3-5-15/h6-7H,1-5,14H2 |
| InChIKey | OWTQVUVZEFVQTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|