C15H21F2N3 — CID 115506976
2,4-difluoro-6-(3-piperidin-1-ylpyrrolidin-1-yl)aniline (PubChem CID 115506976) has the molecular formula C15H21F2N3 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2,4-difluoro-6-(3-piperidin-1-ylpyrrolidin-1-yl)aniline.
| Compound Name | 2,4-difluoro-6-(3-piperidin-1-ylpyrrolidin-1-yl)aniline |
|---|---|
| PubChem CID | 115506976 |
| Molecular Formula | C15H21F2N3 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2,4-difluoro-6-(3-piperidin-1-ylpyrrolidin-1-yl)aniline |
| SMILES | Nc1c(F)cc(F)cc1N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C15H21F2N3/c16-11-8-13(17)15(18)14(9-11)20-7-4-12(10-20)19-5-2-1-3-6-19/h8-9,12H,1-7,10,18H2 |
| InChIKey | JGBOCTOODSTGGH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|