C12H16F2N2O2 — CID 103530569
2-(3,4-dimethoxypyrrolidin-1-yl)-4,6-difluoroaniline (PubChem CID 103530569) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)-4,6-difluoroaniline.
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-4,6-difluoroaniline |
|---|---|
| PubChem CID | 103530569 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-4,6-difluoroaniline |
| SMILES | COC1CN(c2cc(F)cc(F)c2N)CC1OC |
| InChI | InChI=1S/C12H16F2N2O2/c1-17-10-5-16(6-11(10)18-2)9-4-7(13)3-8(14)12(9)15/h3-4,10-11H,5-6,15H2,1-2H3 |
| InChIKey | KVFOLJBOCNURMP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|