C13H22N4O2S — CID 102886778
N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrazin-2-yl]methyl]propan-1-amine (PubChem CID 102886778) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrazin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrazin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102886778 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrazin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cncc(N2CCS(=O)(=O)CC2C)n1 |
| InChI | InChI=1S/C13H22N4O2S/c1-3-4-14-7-12-8-15-9-13(16-12)17-5-6-20(18,19)10-11(17)2/h8-9,11,14H,3-7,10H2,1-2H3 |
| InChIKey | LRPVLZOXTXKNDZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|