C15H15ClN2OS2 — CID 79525560
2-(2-amino-5-chlorophenyl)sulfanyl-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone (PubChem CID 79525560) has the molecular formula C15H15ClN2OS2 and a molecular weight of 338.89 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)sulfanyl-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone.
| Compound Name | 2-(2-amino-5-chlorophenyl)sulfanyl-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 79525560 |
| Molecular Formula | C15H15ClN2OS2 |
| Molecular Weight | 338.89 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)sulfanyl-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
| SMILES | Nc1ccc(Cl)cc1SCC(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C15H15ClN2OS2/c16-11-1-2-12(17)14(7-11)21-9-15(19)18-5-3-13-10(8-18)4-6-20-13/h1-2,4,6-7H,3,5,8-9,17H2 |
| InChIKey | RLERPPCROOCTCC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|