C14H20N4O4S — CID 75370861
2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-nitrobenzenesulfonamide (PubChem CID 75370861) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 75370861 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C14H20N4O4S/c15-23(21,22)14-9-11(18(19)20)4-5-13(14)17-8-7-16-6-2-1-3-12(16)10-17/h4-5,9,12H,1-3,6-8,10H2,(H2,15,21,22) |
| InChIKey | OEDVHSSHJJNOTL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|