C15H15F3N4O4S2 — CID 133387907
5-nitro-2-[3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]benzenesulfonamide (PubChem CID 133387907) has the molecular formula C15H15F3N4O4S2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 5-nitro-2-[3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]benzenesulfonamide.
| Compound Name | 5-nitro-2-[3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 133387907 |
| Molecular Formula | C15H15F3N4O4S2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 5-nitro-2-[3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CCCC(c2nc(C(F)(F)F)cs2)C1 |
| InChI | InChI=1S/C15H15F3N4O4S2/c16-15(17,18)13-8-27-14(20-13)9-2-1-5-21(7-9)11-4-3-10(22(23)24)6-12(11)28(19,25)26/h3-4,6,8-9H,1-2,5,7H2,(H2,19,25,26) |
| InChIKey | UZCOACBKOPUBDN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|