C15H15F3N4O2S — CID 133402902
2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 133402902) has the molecular formula C15H15F3N4O2S and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 133402902 |
| Molecular Formula | C15H15F3N4O2S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | Cc1cc(N2CCCC(c3nc(C(F)(F)F)cs3)C2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F3N4O2S/c1-9-5-13(19-6-11(9)22(23)24)21-4-2-3-10(7-21)14-20-12(8-25-14)15(16,17)18/h5-6,8,10H,2-4,7H2,1H3 |
| InChIKey | RHTIYRYXDMAOMP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|