C21H25N5O2 — CID 133339938
2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-1-propan-2-ylbenzimidazole (PubChem CID 133339938) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-1-propan-2-ylbenzimidazole.
| Compound Name | 2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-1-propan-2-ylbenzimidazole |
|---|---|
| PubChem CID | 133339938 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-[1-(4-methyl-5-nitro-2-pyridinyl)piperidin-3-yl]-1-propan-2-ylbenzimidazole |
| SMILES | Cc1cc(N2CCCC(c3nc4ccccc4n3C(C)C)C2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N5O2/c1-14(2)25-18-9-5-4-8-17(18)23-21(25)16-7-6-10-24(13-16)20-11-15(3)19(12-22-20)26(27)28/h4-5,8-9,11-12,14,16H,6-7,10,13H2,1-3H3 |
| InChIKey | LACSKODFLSHBCJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|