C21H25N7O5 — CID 171816509
(2R,3R,4S,5R)-2-[8-(ethylamino)-6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 171816509) has the molecular formula C21H25N7O5 and a molecular weight of 455.48 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[8-(ethylamino)-6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[8-(ethylamino)-6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 171816509 |
| Molecular Formula | C21H25N7O5 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[8-(ethylamino)-6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | CCNc1nc2c(N3CCc4ccc([N+](=O)[O-])cc4C3)ncnc2n1[C@@H]1O[C@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H25N7O5/c1-3-22-21-25-15-18(26-7-6-12-4-5-14(28(31)32)8-13(12)9-26)23-10-24-19(15)27(21)20-17(30)16(29)11(2)33-20/h4-5,8,10-11,16-17,20,29-30H,3,6-7,9H2,1-2H3,(H,22,25)/t11-,16-,17-,20-/m1/s1 |
| InChIKey | ACHMAVWXUPVCKH-WCYMFGLZSA-N |
| XLogP | 1.37 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|