C23H28N6O4 — CID 169003821
[1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 169003821) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is [1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 169003821 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-4-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | O=C(C1CCN(c2cc(N3CCOCC3)ncn2)CC1)N1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C23H28N6O4/c30-23(28-8-3-17-1-2-20(29(31)32)13-19(17)15-28)18-4-6-26(7-5-18)21-14-22(25-16-24-21)27-9-11-33-12-10-27/h1-2,13-14,16,18H,3-12,15H2 |
| InChIKey | QQPILQGZLWSVQN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 104.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|