C26H27N5O5 — CID 163649660
8-methyl-7-(7-nitro-3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-(oxan-4-yl)-7,8-dihydro-5H-imidazo[1,5-a]quinoxalin-4-one (PubChem CID 163649660) has the molecular formula C26H27N5O5 and a molecular weight of 489.53 g/mol. Its IUPAC name is 8-methyl-7-(7-nitro-3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-(oxan-4-yl)-7,8-dihydro-5H-imidazo[1,5-a]quinoxalin-4-one.
| Compound Name | 8-methyl-7-(7-nitro-3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-(oxan-4-yl)-7,8-dihydro-5H-imidazo[1,5-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 163649660 |
| Molecular Formula | C26H27N5O5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 8-methyl-7-(7-nitro-3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-(oxan-4-yl)-7,8-dihydro-5H-imidazo[1,5-a]quinoxalin-4-one |
| SMILES | CC1C=c2c([nH]c(=O)c3cnc(C4CCOCC4)n23)=CC1C(=O)N1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C26H27N5O5/c1-15-10-22-21(28-25(32)23-13-27-24(30(22)23)17-5-8-36-9-6-17)12-20(15)26(33)29-7-4-16-2-3-19(31(34)35)11-18(16)14-29/h2-3,10-13,15,17,20H,4-9,14H2,1H3,(H,28,32) |
| InChIKey | RGTJPKFQMLCEOW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|