C18H22ClN5O3 — CID 120932214
[(3R,4S)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone;hydrochloride (PubChem CID 120932214) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is [(3R,4S)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone;hydrochloride.
| Compound Name | [(3R,4S)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120932214 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [(3R,4S)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanone;hydrochloride |
| SMILES | Cl.Cn1cc([C@H]2CNC[C@@H]2C(=O)N2CCc3ccc([N+](=O)[O-])cc3C2)cn1 |
| InChI | InChI=1S/C18H21N5O3.ClH/c1-21-10-14(7-20-21)16-8-19-9-17(16)18(24)22-5-4-12-2-3-15(23(25)26)6-13(12)11-22;/h2-3,6-7,10,16-17,19H,4-5,8-9,11H2,1H3;1H/t16-,17+;/m1./s1 |
| InChIKey | DLKNBCVUMJNRTH-PPPUBMIESA-N |
| XLogP | 1.64 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|