C16H20ClN5O3 — CID 120917039
(3R,4S)-N-(4-methyl-3-nitrophenyl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120917039) has the molecular formula C16H20ClN5O3 and a molecular weight of 365.82 g/mol. Its IUPAC name is (3R,4S)-N-(4-methyl-3-nitrophenyl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-N-(4-methyl-3-nitrophenyl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120917039 |
| Molecular Formula | C16H20ClN5O3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (3R,4S)-N-(4-methyl-3-nitrophenyl)-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)[C@H]2CNC[C@@H]2c2cnn(C)c2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H19N5O3.ClH/c1-10-3-4-12(5-15(10)21(23)24)19-16(22)14-8-17-7-13(14)11-6-18-20(2)9-11;/h3-6,9,13-14,17H,7-8H2,1-2H3,(H,19,22);1H/t13-,14+;/m1./s1 |
| InChIKey | DGOSFTPFZFECEL-DFQHDRSWSA-N |
| XLogP | 2.00 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|