C17H22ClN5O3 — CID 120934969
(3R,4S)-4-(1-methylpyrazol-4-yl)-N-[2-(2-nitrophenyl)ethyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120934969) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is (3R,4S)-4-(1-methylpyrazol-4-yl)-N-[2-(2-nitrophenyl)ethyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-4-(1-methylpyrazol-4-yl)-N-[2-(2-nitrophenyl)ethyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120934969 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (3R,4S)-4-(1-methylpyrazol-4-yl)-N-[2-(2-nitrophenyl)ethyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc([C@H]2CNC[C@@H]2C(=O)NCCc2ccccc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H21N5O3.ClH/c1-21-11-13(8-20-21)14-9-18-10-15(14)17(23)19-7-6-12-4-2-3-5-16(12)22(24)25;/h2-5,8,11,14-15,18H,6-7,9-10H2,1H3,(H,19,23);1H/t14-,15+;/m1./s1 |
| InChIKey | SVAPADDJMXYIRG-LIOBNPLQSA-N |
| XLogP | 1.41 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|